C22H21ClF8N4O3 — CID 171837479
aminomethyl 2-[(3-chloro-2,4-difluorophenyl)-methylcarbamoyl]oxy-6-cyano-3-(trifluoromethyl)benzenecarboximidate;ethane;1,1,1-trifluoroethane (PubChem CID 171837479) has the molecular formula C22H21ClF8N4O3 and a molecular weight of 576.87 g/mol. Its IUPAC name is aminomethyl 2-[(3-chloro-2,4-difluorophenyl)-methylcarbamoyl]oxy-6-cyano-3-(trifluoromethyl)benzenecarboximidate;ethane;1,1,1-trifluoroethane.
| Compound Name | aminomethyl 2-[(3-chloro-2,4-difluorophenyl)-methylcarbamoyl]oxy-6-cyano-3-(trifluoromethyl)benzenecarboximidate;ethane;1,1,1-trifluoroethane |
|---|---|
| PubChem CID | 171837479 |
| Molecular Formula | C22H21ClF8N4O3 |
| Molecular Weight | 576.87 g/mol |
| Exact Mass | 576.12 |
| IUPAC Name | aminomethyl 2-[(3-chloro-2,4-difluorophenyl)-methylcarbamoyl]oxy-6-cyano-3-(trifluoromethyl)benzenecarboximidate;ethane;1,1,1-trifluoroethane |
| SMILES | CC.CC(F)(F)F.[H]/N=C(\OCN)c1c(C#N)ccc(C(F)(F)F)c1OC(=O)N(C)c1ccc(F)c(Cl)c1F |
| InChI | InChI=1S/C18H12ClF5N4O3.C2H3F3.C2H6/c1-28(11-5-4-10(20)13(19)14(11)21)17(29)31-15-9(18(22,23)24)3-2-8(6-25)12(15)16(27)30-7-26;1-2(3,4)5;1-2/h2-5,27H,7,26H2,1H3;1H3;1-2H3/b27-16-;; |
| InChIKey | QJRPZIYCGLJZHP-AAYZDZIVSA-N |
| XLogP | 7.00 |
| TPSA | 112.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.87 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|