C13H12ClF2N3O — CID 168877129
(2S,4S)-N-(3-chloro-2,4-difluorophenyl)-4-cyano-N-methylpyrrolidine-2-carboxamide (PubChem CID 168877129) has the molecular formula C13H12ClF2N3O and a molecular weight of 299.71 g/mol. Its IUPAC name is (2S,4S)-N-(3-chloro-2,4-difluorophenyl)-4-cyano-N-methylpyrrolidine-2-carboxamide.
| Compound Name | (2S,4S)-N-(3-chloro-2,4-difluorophenyl)-4-cyano-N-methylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 168877129 |
| Molecular Formula | C13H12ClF2N3O |
| Molecular Weight | 299.71 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | (2S,4S)-N-(3-chloro-2,4-difluorophenyl)-4-cyano-N-methylpyrrolidine-2-carboxamide |
| SMILES | CN(C(=O)[C@@H]1C[C@H](C#N)CN1)c1ccc(F)c(Cl)c1F |
| InChI | InChI=1S/C13H12ClF2N3O/c1-19(10-3-2-8(15)11(14)12(10)16)13(20)9-4-7(5-17)6-18-9/h2-3,7,9,18H,4,6H2,1H3/t7-,9+/m1/s1 |
| InChIKey | SOEVJGXHIXUZJI-APPZFPTMSA-N |
| XLogP | 2.08 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.71 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|