C15H21ClN2O3 — CID 125138836
(2R,4S)-N-[3-(4-chlorophenoxy)propyl]-4-hydroxy-N-methylpyrrolidine-2-carboxamide (PubChem CID 125138836) has the molecular formula C15H21ClN2O3 and a molecular weight of 312.80 g/mol. Its IUPAC name is (2R,4S)-N-[3-(4-chlorophenoxy)propyl]-4-hydroxy-N-methylpyrrolidine-2-carboxamide.
| Compound Name | (2R,4S)-N-[3-(4-chlorophenoxy)propyl]-4-hydroxy-N-methylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 125138836 |
| Molecular Formula | C15H21ClN2O3 |
| Molecular Weight | 312.80 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | (2R,4S)-N-[3-(4-chlorophenoxy)propyl]-4-hydroxy-N-methylpyrrolidine-2-carboxamide |
| SMILES | CN(CCCOc1ccc(Cl)cc1)C(=O)[C@H]1C[C@H](O)CN1 |
| InChI | InChI=1S/C15H21ClN2O3/c1-18(15(20)14-9-12(19)10-17-14)7-2-8-21-13-5-3-11(16)4-6-13/h3-6,12,14,17,19H,2,7-10H2,1H3/t12-,14+/m0/s1 |
| InChIKey | HRSVQQHIOCFVGS-GXTWGEPZSA-N |
| XLogP | 1.29 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.80 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|