C16H23ClN2O2 — CID 114423293
N-[2-(4-chlorophenoxy)ethyl]-N,4-dimethylpiperidine-2-carboxamide (PubChem CID 114423293) has the molecular formula C16H23ClN2O2 and a molecular weight of 310.82 g/mol. Its IUPAC name is N-[2-(4-chlorophenoxy)ethyl]-N,4-dimethylpiperidine-2-carboxamide.
| Compound Name | N-[2-(4-chlorophenoxy)ethyl]-N,4-dimethylpiperidine-2-carboxamide |
|---|---|
| PubChem CID | 114423293 |
| Molecular Formula | C16H23ClN2O2 |
| Molecular Weight | 310.82 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | N-[2-(4-chlorophenoxy)ethyl]-N,4-dimethylpiperidine-2-carboxamide |
| SMILES | CC1CCNC(C(=O)N(C)CCOc2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C16H23ClN2O2/c1-12-7-8-18-15(11-12)16(20)19(2)9-10-21-14-5-3-13(17)4-6-14/h3-6,12,15,18H,7-11H2,1-2H3 |
| InChIKey | NZQHOYCNTBLQCX-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.82 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |