C12H24N2O3 — CID 114243077
N-[2-(2-hydroxyethoxy)ethyl]-N,4-dimethylpiperidine-2-carboxamide (PubChem CID 114243077) has the molecular formula C12H24N2O3 and a molecular weight of 244.33 g/mol. Its IUPAC name is N-[2-(2-hydroxyethoxy)ethyl]-N,4-dimethylpiperidine-2-carboxamide.
| Compound Name | N-[2-(2-hydroxyethoxy)ethyl]-N,4-dimethylpiperidine-2-carboxamide |
|---|---|
| PubChem CID | 114243077 |
| Molecular Formula | C12H24N2O3 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | N-[2-(2-hydroxyethoxy)ethyl]-N,4-dimethylpiperidine-2-carboxamide |
| SMILES | CC1CCNC(C(=O)N(C)CCOCCO)C1 |
| InChI | InChI=1S/C12H24N2O3/c1-10-3-4-13-11(9-10)12(16)14(2)5-7-17-8-6-15/h10-11,13,15H,3-9H2,1-2H3 |
| InChIKey | FYTICUCHLMILHW-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|