C12H11ClF5N — CID 171482129
3-chloro-2,4-difluoro-N-methyl-N-[3-(trifluoromethyl)cyclobutyl]aniline (PubChem CID 171482129) has the molecular formula C12H11ClF5N and a molecular weight of 299.67 g/mol. Its IUPAC name is 3-chloro-2,4-difluoro-N-methyl-N-[3-(trifluoromethyl)cyclobutyl]aniline.
| Compound Name | 3-chloro-2,4-difluoro-N-methyl-N-[3-(trifluoromethyl)cyclobutyl]aniline |
|---|---|
| PubChem CID | 171482129 |
| Molecular Formula | C12H11ClF5N |
| Molecular Weight | 299.67 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | 3-chloro-2,4-difluoro-N-methyl-N-[3-(trifluoromethyl)cyclobutyl]aniline |
| SMILES | CN(c1ccc(F)c(Cl)c1F)C1CC(C(F)(F)F)C1 |
| InChI | InChI=1S/C12H11ClF5N/c1-19(7-4-6(5-7)12(16,17)18)9-3-2-8(14)10(13)11(9)15/h2-3,6-7H,4-5H2,1H3 |
| InChIKey | QBBMRLPOSIJCEO-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.67 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|