C13H10ClF5O — CID 166045484
(3-chloro-2,4-difluorophenyl)-[3-(trifluoromethyl)cyclopentyl]methanone (PubChem CID 166045484) has the molecular formula C13H10ClF5O and a molecular weight of 312.67 g/mol. Its IUPAC name is (3-chloro-2,4-difluorophenyl)-[3-(trifluoromethyl)cyclopentyl]methanone.
| Compound Name | (3-chloro-2,4-difluorophenyl)-[3-(trifluoromethyl)cyclopentyl]methanone |
|---|---|
| PubChem CID | 166045484 |
| Molecular Formula | C13H10ClF5O |
| Molecular Weight | 312.67 g/mol |
| Exact Mass | 312.03 |
| IUPAC Name | (3-chloro-2,4-difluorophenyl)-[3-(trifluoromethyl)cyclopentyl]methanone |
| SMILES | O=C(c1ccc(F)c(Cl)c1F)C1CCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C13H10ClF5O/c14-10-9(15)4-3-8(11(10)16)12(20)6-1-2-7(5-6)13(17,18)19/h3-4,6-7H,1-2,5H2 |
| InChIKey | YZYCGXKPQOGQSQ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.67 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|