C13H13ClF5N — CID 171482126
3-chloro-2,4-difluoro-N-[[3-(trifluoromethyl)cyclopentyl]methyl]aniline (PubChem CID 171482126) has the molecular formula C13H13ClF5N and a molecular weight of 313.70 g/mol. Its IUPAC name is 3-chloro-2,4-difluoro-N-[[3-(trifluoromethyl)cyclopentyl]methyl]aniline.
| Compound Name | 3-chloro-2,4-difluoro-N-[[3-(trifluoromethyl)cyclopentyl]methyl]aniline |
|---|---|
| PubChem CID | 171482126 |
| Molecular Formula | C13H13ClF5N |
| Molecular Weight | 313.70 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 3-chloro-2,4-difluoro-N-[[3-(trifluoromethyl)cyclopentyl]methyl]aniline |
| SMILES | Fc1ccc(NCC2CCC(C(F)(F)F)C2)c(F)c1Cl |
| InChI | InChI=1S/C13H13ClF5N/c14-11-9(15)3-4-10(12(11)16)20-6-7-1-2-8(5-7)13(17,18)19/h3-4,7-8,20H,1-2,5-6H2 |
| InChIKey | AHPDLJDECGNKCZ-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.70 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|