C19H25ClF5NOS — CID 167527880
(R)-N-[1-(3-chloro-2,4-difluorophenyl)-2-[4-(trifluoromethyl)cyclohexyl]ethyl]-2-methylpropane-2-sulfinamide (PubChem CID 167527880) has the molecular formula C19H25ClF5NOS and a molecular weight of 445.93 g/mol. Its IUPAC name is (R)-N-[1-(3-chloro-2,4-difluorophenyl)-2-[4-(trifluoromethyl)cyclohexyl]ethyl]-2-methylpropane-2-sulfinamide.
| Compound Name | (R)-N-[1-(3-chloro-2,4-difluorophenyl)-2-[4-(trifluoromethyl)cyclohexyl]ethyl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 167527880 |
| Molecular Formula | C19H25ClF5NOS |
| Molecular Weight | 445.93 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | (R)-N-[1-(3-chloro-2,4-difluorophenyl)-2-[4-(trifluoromethyl)cyclohexyl]ethyl]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)[S@@](=O)NC(CC1CCC(C(F)(F)F)CC1)c1ccc(F)c(Cl)c1F |
| InChI | InChI=1S/C19H25ClF5NOS/c1-18(2,3)28(27)26-15(13-8-9-14(21)16(20)17(13)22)10-11-4-6-12(7-5-11)19(23,24)25/h8-9,11-12,15,26H,4-7,10H2,1-3H3/t11?,12?,15?,28-/m1/s1 |
| InChIKey | BRZBUUZAVBVGQE-GOWAYXNDSA-N |
| XLogP | 6.47 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.93 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|