C12H16BrClFNOS — CID 163603996
(R)-N-[(1R)-1-(4-bromo-2-chloro-3-fluorophenyl)ethyl]-2-methylpropane-2-sulfinamide (PubChem CID 163603996) has the molecular formula C12H16BrClFNOS and a molecular weight of 356.69 g/mol. Its IUPAC name is (R)-N-[(1R)-1-(4-bromo-2-chloro-3-fluorophenyl)ethyl]-2-methylpropane-2-sulfinamide.
| Compound Name | (R)-N-[(1R)-1-(4-bromo-2-chloro-3-fluorophenyl)ethyl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 163603996 |
| Molecular Formula | C12H16BrClFNOS |
| Molecular Weight | 356.69 g/mol |
| Exact Mass | 354.98 |
| IUPAC Name | (R)-N-[(1R)-1-(4-bromo-2-chloro-3-fluorophenyl)ethyl]-2-methylpropane-2-sulfinamide |
| SMILES | C[C@@H](N[S@](=O)C(C)(C)C)c1ccc(Br)c(F)c1Cl |
| InChI | InChI=1S/C12H16BrClFNOS/c1-7(16-18(17)12(2,3)4)8-5-6-9(13)11(15)10(8)14/h5-7,16H,1-4H3/t7-,18-/m1/s1 |
| InChIKey | HAEPSDUCMBKJLY-LWESTGQBSA-N |
| XLogP | 4.35 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.69 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|