C12H17ClFNOS — CID 172536184
(R)-N-[1-(2-chloro-3-fluorophenyl)ethyl]-2-methylpropane-2-sulfinamide (PubChem CID 172536184) has the molecular formula C12H17ClFNOS and a molecular weight of 277.79 g/mol. Its IUPAC name is (R)-N-[1-(2-chloro-3-fluorophenyl)ethyl]-2-methylpropane-2-sulfinamide.
| Compound Name | (R)-N-[1-(2-chloro-3-fluorophenyl)ethyl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 172536184 |
| Molecular Formula | C12H17ClFNOS |
| Molecular Weight | 277.79 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | (R)-N-[1-(2-chloro-3-fluorophenyl)ethyl]-2-methylpropane-2-sulfinamide |
| SMILES | CC(N[S@](=O)C(C)(C)C)c1cccc(F)c1Cl |
| InChI | InChI=1S/C12H17ClFNOS/c1-8(15-17(16)12(2,3)4)9-6-5-7-10(14)11(9)13/h5-8,15H,1-4H3/t8?,17-/m1/s1 |
| InChIKey | LXAVJEINJXLEQV-KCHMSYDNSA-N |
| XLogP | 3.59 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.79 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |