C13H14Cl2F5NO — CID 175879282
3-chloro-2,4-difluoro-N-[[(2R,5S)-5-(trifluoromethyl)oxan-2-yl]methyl]aniline;hydrochloride (PubChem CID 175879282) has the molecular formula C13H14Cl2F5NO and a molecular weight of 366.16 g/mol. Its IUPAC name is 3-chloro-2,4-difluoro-N-[[(2R,5S)-5-(trifluoromethyl)oxan-2-yl]methyl]aniline;hydrochloride.
| Compound Name | 3-chloro-2,4-difluoro-N-[[(2R,5S)-5-(trifluoromethyl)oxan-2-yl]methyl]aniline;hydrochloride |
|---|---|
| PubChem CID | 175879282 |
| Molecular Formula | C13H14Cl2F5NO |
| Molecular Weight | 366.16 g/mol |
| Exact Mass | 365.04 |
| IUPAC Name | 3-chloro-2,4-difluoro-N-[[(2R,5S)-5-(trifluoromethyl)oxan-2-yl]methyl]aniline;hydrochloride |
| SMILES | Cl.Fc1ccc(NC[C@H]2CC[C@H](C(F)(F)F)CO2)c(F)c1Cl |
| InChI | InChI=1S/C13H13ClF5NO.ClH/c14-11-9(15)3-4-10(12(11)16)20-5-8-2-1-7(6-21-8)13(17,18)19;/h3-4,7-8,20H,1-2,5-6H2;1H/t7-,8+;/m0./s1 |
| InChIKey | GRMDOVDBDDZTRL-KZYPOYLOSA-N |
| XLogP | 4.81 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.16 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|