C11H7Cl2F5N2S — CID 171059547
3-chloro-2,4-difluoro-N-[[2-(trifluoromethyl)-1,3-thiazol-5-yl]methyl]aniline;hydrochloride (PubChem CID 171059547) has the molecular formula C11H7Cl2F5N2S and a molecular weight of 365.15 g/mol. Its IUPAC name is 3-chloro-2,4-difluoro-N-[[2-(trifluoromethyl)-1,3-thiazol-5-yl]methyl]aniline;hydrochloride.
| Compound Name | 3-chloro-2,4-difluoro-N-[[2-(trifluoromethyl)-1,3-thiazol-5-yl]methyl]aniline;hydrochloride |
|---|---|
| PubChem CID | 171059547 |
| Molecular Formula | C11H7Cl2F5N2S |
| Molecular Weight | 365.15 g/mol |
| Exact Mass | 363.96 |
| IUPAC Name | 3-chloro-2,4-difluoro-N-[[2-(trifluoromethyl)-1,3-thiazol-5-yl]methyl]aniline;hydrochloride |
| SMILES | Cl.Fc1ccc(NCc2cnc(C(F)(F)F)s2)c(F)c1Cl |
| InChI | InChI=1S/C11H6ClF5N2S.ClH/c12-8-6(13)1-2-7(9(8)14)18-3-5-4-19-10(20-5)11(15,16)17;/h1-2,4,18H,3H2;1H |
| InChIKey | CPOZMHUJIGHGGX-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.15 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|