C13H13ClF2O — CID 167436532
(3-chloro-2,4-difluorophenyl)-(3,3-dimethylcyclobutyl)methanone (PubChem CID 167436532) has the molecular formula C13H13ClF2O and a molecular weight of 258.69 g/mol. Its IUPAC name is (3-chloro-2,4-difluorophenyl)-(3,3-dimethylcyclobutyl)methanone.
| Compound Name | (3-chloro-2,4-difluorophenyl)-(3,3-dimethylcyclobutyl)methanone |
|---|---|
| PubChem CID | 167436532 |
| Molecular Formula | C13H13ClF2O |
| Molecular Weight | 258.69 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | (3-chloro-2,4-difluorophenyl)-(3,3-dimethylcyclobutyl)methanone |
| SMILES | CC1(C)CC(C(=O)c2ccc(F)c(Cl)c2F)C1 |
| InChI | InChI=1S/C13H13ClF2O/c1-13(2)5-7(6-13)12(17)8-3-4-9(15)10(14)11(8)16/h3-4,7H,5-6H2,1-2H3 |
| InChIKey | ONYLRJMAPZMBEA-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.69 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|