C11H11Cl2F2NO — CID 162509745
(3-chloro-2,4-difluorophenyl)-(3-methylazetidin-3-yl)methanone;hydrochloride (PubChem CID 162509745) has the molecular formula C11H11Cl2F2NO and a molecular weight of 282.12 g/mol. Its IUPAC name is (3-chloro-2,4-difluorophenyl)-(3-methylazetidin-3-yl)methanone;hydrochloride.
| Compound Name | (3-chloro-2,4-difluorophenyl)-(3-methylazetidin-3-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 162509745 |
| Molecular Formula | C11H11Cl2F2NO |
| Molecular Weight | 282.12 g/mol |
| Exact Mass | 281.02 |
| IUPAC Name | (3-chloro-2,4-difluorophenyl)-(3-methylazetidin-3-yl)methanone;hydrochloride |
| SMILES | CC1(C(=O)c2ccc(F)c(Cl)c2F)CNC1.Cl |
| InChI | InChI=1S/C11H10ClF2NO.ClH/c1-11(4-15-5-11)10(16)6-2-3-7(13)8(12)9(6)14;/h2-3,15H,4-5H2,1H3;1H |
| InChIKey | YJPDROSXPSYOBB-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.12 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|