C11H10ClF2NOS — CID 164891876
(3-chloro-2,4-difluorophenyl)-thiomorpholin-4-ylmethanone (PubChem CID 164891876) has the molecular formula C11H10ClF2NOS and a molecular weight of 277.72 g/mol. Its IUPAC name is (3-chloro-2,4-difluorophenyl)-thiomorpholin-4-ylmethanone.
| Compound Name | (3-chloro-2,4-difluorophenyl)-thiomorpholin-4-ylmethanone |
|---|---|
| PubChem CID | 164891876 |
| Molecular Formula | C11H10ClF2NOS |
| Molecular Weight | 277.72 g/mol |
| Exact Mass | 277.01 |
| IUPAC Name | (3-chloro-2,4-difluorophenyl)-thiomorpholin-4-ylmethanone |
| SMILES | O=C(c1ccc(F)c(Cl)c1F)N1CCSCC1 |
| InChI | InChI=1S/C11H10ClF2NOS/c12-9-8(13)2-1-7(10(9)14)11(16)15-3-5-17-6-4-15/h1-2H,3-6H2 |
| InChIKey | OSFCCOYMYZTXJY-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.72 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|