C15H17BrClFO — CID 106761798
(4-bromo-3-chloro-2-fluorophenyl)-(4,4-dimethylcyclohexyl)methanone (PubChem CID 106761798) has the molecular formula C15H17BrClFO and a molecular weight of 347.66 g/mol. Its IUPAC name is (4-bromo-3-chloro-2-fluorophenyl)-(4,4-dimethylcyclohexyl)methanone.
| Compound Name | (4-bromo-3-chloro-2-fluorophenyl)-(4,4-dimethylcyclohexyl)methanone |
|---|---|
| PubChem CID | 106761798 |
| Molecular Formula | C15H17BrClFO |
| Molecular Weight | 347.66 g/mol |
| Exact Mass | 346.01 |
| IUPAC Name | (4-bromo-3-chloro-2-fluorophenyl)-(4,4-dimethylcyclohexyl)methanone |
| SMILES | CC1(C)CCC(C(=O)c2ccc(Br)c(Cl)c2F)CC1 |
| InChI | InChI=1S/C15H17BrClFO/c1-15(2)7-5-9(6-8-15)14(19)10-3-4-11(16)12(17)13(10)18/h3-4,9H,5-8H2,1-2H3 |
| InChIKey | ZFTCCYGRZJSKQY-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.66 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|