C16H8ClF8NO2 — CID 171507331
[2,3-bis(trifluoromethyl)phenyl] N-(3-chloro-2,4-difluorophenyl)-N-(trideuteriomethyl)carbamate (PubChem CID 171507331) has the molecular formula C16H8ClF8NO2 and a molecular weight of 436.70 g/mol. Its IUPAC name is [2,3-bis(trifluoromethyl)phenyl] N-(3-chloro-2,4-difluorophenyl)-N-(trideuteriomethyl)carbamate.
| Compound Name | [2,3-bis(trifluoromethyl)phenyl] N-(3-chloro-2,4-difluorophenyl)-N-(trideuteriomethyl)carbamate |
|---|---|
| PubChem CID | 171507331 |
| Molecular Formula | C16H8ClF8NO2 |
| Molecular Weight | 436.70 g/mol |
| Exact Mass | 436.03 |
| IUPAC Name | [2,3-bis(trifluoromethyl)phenyl] N-(3-chloro-2,4-difluorophenyl)-N-(trideuteriomethyl)carbamate |
| SMILES | [2H]C([2H])([2H])N(C(=O)Oc1cccc(C(F)(F)F)c1C(F)(F)F)c1ccc(F)c(Cl)c1F |
| InChI | InChI=1S/C16H8ClF8NO2/c1-26(9-6-5-8(18)12(17)13(9)19)14(27)28-10-4-2-3-7(15(20,21)22)11(10)16(23,24)25/h2-6H,1H3/i1D3 |
| InChIKey | VKPNOJJZOPLMGS-FIBGUPNXSA-N |
| XLogP | 6.29 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.70 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|