C11H9ClF5N — CID 171482133
3-chloro-2,4-difluoro-N-methyl-N-[(1S,2S)-2-(trifluoromethyl)cyclopropyl]aniline (PubChem CID 171482133) has the molecular formula C11H9ClF5N and a molecular weight of 285.64 g/mol. Its IUPAC name is 3-chloro-2,4-difluoro-N-methyl-N-[(1S,2S)-2-(trifluoromethyl)cyclopropyl]aniline.
| Compound Name | 3-chloro-2,4-difluoro-N-methyl-N-[(1S,2S)-2-(trifluoromethyl)cyclopropyl]aniline |
|---|---|
| PubChem CID | 171482133 |
| Molecular Formula | C11H9ClF5N |
| Molecular Weight | 285.64 g/mol |
| Exact Mass | 285.03 |
| IUPAC Name | 3-chloro-2,4-difluoro-N-methyl-N-[(1S,2S)-2-(trifluoromethyl)cyclopropyl]aniline |
| SMILES | CN(c1ccc(F)c(Cl)c1F)[C@H]1C[C@@H]1C(F)(F)F |
| InChI | InChI=1S/C11H9ClF5N/c1-18(8-4-5(8)11(15,16)17)7-3-2-6(13)9(12)10(7)14/h2-3,5,8H,4H2,1H3/t5-,8-/m0/s1 |
| InChIKey | QUQBGJKMVAHXAM-XNCJUZBTSA-N |
| XLogP | 4.01 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.64 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|