C15H15ClF5NOS — CID 172729464
(R)-N-[(3-chloro-2,4-difluorophenyl)-[(1R,2R)-2-(trifluoromethyl)cyclopropyl]methylidene]-2-methylpropane-2-sulfinamide (PubChem CID 172729464) has the molecular formula C15H15ClF5NOS and a molecular weight of 387.80 g/mol. Its IUPAC name is (R)-N-[(3-chloro-2,4-difluorophenyl)-[(1R,2R)-2-(trifluoromethyl)cyclopropyl]methylidene]-2-methylpropane-2-sulfinamide.
| Compound Name | (R)-N-[(3-chloro-2,4-difluorophenyl)-[(1R,2R)-2-(trifluoromethyl)cyclopropyl]methylidene]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 172729464 |
| Molecular Formula | C15H15ClF5NOS |
| Molecular Weight | 387.80 g/mol |
| Exact Mass | 387.05 |
| IUPAC Name | (R)-N-[(3-chloro-2,4-difluorophenyl)-[(1R,2R)-2-(trifluoromethyl)cyclopropyl]methylidene]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)[S@@](=O)N=C(c1ccc(F)c(Cl)c1F)[C@@H]1C[C@H]1C(F)(F)F |
| InChI | InChI=1S/C15H15ClF5NOS/c1-14(2,3)24(23)22-13(8-6-9(8)15(19,20)21)7-4-5-10(17)11(16)12(7)18/h4-5,8-9H,6H2,1-3H3/t8-,9-,24-/m1/s1 |
| InChIKey | HPCWYUDHDHKIDX-SECOCPKTSA-N |
| XLogP | 5.07 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.80 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|