C14H11Cl2F5N2O — CID 175417341
N-(3-chloro-2,4-difluorophenyl)-N-methyl-6-(2,2,2-trifluoroethoxy)pyridin-3-amine;hydrochloride (PubChem CID 175417341) has the molecular formula C14H11Cl2F5N2O and a molecular weight of 389.15 g/mol. Its IUPAC name is N-(3-chloro-2,4-difluorophenyl)-N-methyl-6-(2,2,2-trifluoroethoxy)pyridin-3-amine;hydrochloride.
| Compound Name | N-(3-chloro-2,4-difluorophenyl)-N-methyl-6-(2,2,2-trifluoroethoxy)pyridin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 175417341 |
| Molecular Formula | C14H11Cl2F5N2O |
| Molecular Weight | 389.15 g/mol |
| Exact Mass | 388.02 |
| IUPAC Name | N-(3-chloro-2,4-difluorophenyl)-N-methyl-6-(2,2,2-trifluoroethoxy)pyridin-3-amine;hydrochloride |
| SMILES | CN(c1ccc(OCC(F)(F)F)nc1)c1ccc(F)c(Cl)c1F.Cl |
| InChI | InChI=1S/C14H10ClF5N2O.ClH/c1-22(10-4-3-9(16)12(15)13(10)17)8-2-5-11(21-6-8)23-7-14(18,19)20;/h2-6H,7H2,1H3;1H |
| InChIKey | CKAIHBASSQLMHW-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.15 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|