C13H6ClF5N2O2 — CID 166110876
(3-chloro-2,4-difluorophenyl)-[2-(2,2,2-trifluoroethoxy)pyrimidin-5-yl]methanone (PubChem CID 166110876) has the molecular formula C13H6ClF5N2O2 and a molecular weight of 352.65 g/mol. Its IUPAC name is (3-chloro-2,4-difluorophenyl)-[2-(2,2,2-trifluoroethoxy)pyrimidin-5-yl]methanone.
| Compound Name | (3-chloro-2,4-difluorophenyl)-[2-(2,2,2-trifluoroethoxy)pyrimidin-5-yl]methanone |
|---|---|
| PubChem CID | 166110876 |
| Molecular Formula | C13H6ClF5N2O2 |
| Molecular Weight | 352.65 g/mol |
| Exact Mass | 352.00 |
| IUPAC Name | (3-chloro-2,4-difluorophenyl)-[2-(2,2,2-trifluoroethoxy)pyrimidin-5-yl]methanone |
| SMILES | O=C(c1cnc(OCC(F)(F)F)nc1)c1ccc(F)c(Cl)c1F |
| InChI | InChI=1S/C13H6ClF5N2O2/c14-9-8(15)2-1-7(10(9)16)11(22)6-3-20-12(21-4-6)23-5-13(17,18)19/h1-4H,5H2 |
| InChIKey | PCWBLRVRHOVVPE-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.65 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|