C13H13ClF2N2O2 — CID 176648273
(2S)-N-(3-chloro-2,4-difluorophenyl)-N,4-dimethyl-5-oxopyrrolidine-2-carboxamide (PubChem CID 176648273) has the molecular formula C13H13ClF2N2O2 and a molecular weight of 302.71 g/mol. Its IUPAC name is (2S)-N-(3-chloro-2,4-difluorophenyl)-N,4-dimethyl-5-oxopyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-(3-chloro-2,4-difluorophenyl)-N,4-dimethyl-5-oxopyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 176648273 |
| Molecular Formula | C13H13ClF2N2O2 |
| Molecular Weight | 302.71 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | (2S)-N-(3-chloro-2,4-difluorophenyl)-N,4-dimethyl-5-oxopyrrolidine-2-carboxamide |
| SMILES | CC1C[C@@H](C(=O)N(C)c2ccc(F)c(Cl)c2F)NC1=O |
| InChI | InChI=1S/C13H13ClF2N2O2/c1-6-5-8(17-12(6)19)13(20)18(2)9-4-3-7(15)10(14)11(9)16/h3-4,6,8H,5H2,1-2H3,(H,17,19)/t6?,8-/m0/s1 |
| InChIKey | BKJAQVRVWANCAZ-XDKWHASVSA-N |
| XLogP | 2.11 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.71 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|