C24H12F18O4 — CID 130220137
bis[2,4,6-tris(trifluoromethyl)phenyl] 2-propylpropanedioate (PubChem CID 130220137) has the molecular formula C24H12F18O4 and a molecular weight of 706.32 g/mol. Its IUPAC name is bis[2,4,6-tris(trifluoromethyl)phenyl] 2-propylpropanedioate.
| Compound Name | bis[2,4,6-tris(trifluoromethyl)phenyl] 2-propylpropanedioate |
|---|---|
| PubChem CID | 130220137 |
| Molecular Formula | C24H12F18O4 |
| Molecular Weight | 706.32 g/mol |
| Exact Mass | 706.04 |
| IUPAC Name | bis[2,4,6-tris(trifluoromethyl)phenyl] 2-propylpropanedioate |
| SMILES | CCCC(C(=O)Oc1c(C(F)(F)F)cc(C(F)(F)F)cc1C(F)(F)F)C(=O)Oc1c(C(F)(F)F)cc(C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C24H12F18O4/c1-2-3-10(17(43)45-15-11(21(31,32)33)4-8(19(25,26)27)5-12(15)22(34,35)36)18(44)46-16-13(23(37,38)39)6-9(20(28,29)30)7-14(16)24(40,41)42/h4-7,10H,2-3H2,1H3 |
| InChIKey | IZCSGGWMCIGQBD-UHFFFAOYSA-N |
| XLogP | 9.73 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.32 |
| LogP ≤ 5 | 9.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|