C12H20O3S2 — CID 10978739
[2,2-bis(methylsulfanyl)-1-(2-oxocyclohexyl)ethyl] acetate (PubChem CID 10978739) has the molecular formula C12H20O3S2 and a molecular weight of 276.42 g/mol. Its IUPAC name is [2,2-bis(methylsulfanyl)-1-(2-oxocyclohexyl)ethyl] acetate.
| Compound Name | [2,2-bis(methylsulfanyl)-1-(2-oxocyclohexyl)ethyl] acetate |
|---|---|
| PubChem CID | 10978739 |
| Molecular Formula | C12H20O3S2 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | [2,2-bis(methylsulfanyl)-1-(2-oxocyclohexyl)ethyl] acetate |
| SMILES | CSC(SC)C(OC(C)=O)C1CCCCC1=O |
| InChI | InChI=1S/C12H20O3S2/c1-8(13)15-11(12(16-2)17-3)9-6-4-5-7-10(9)14/h9,11-12H,4-7H2,1-3H3 |
| InChIKey | RUXLBFVFIXVAIJ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|