C10H18O2S2 — CID 10955513
2-[1-hydroxy-2,2-bis(methylsulfanyl)ethyl]cyclohexan-1-one (PubChem CID 10955513) has the molecular formula C10H18O2S2 and a molecular weight of 234.39 g/mol. Its IUPAC name is 2-[1-hydroxy-2,2-bis(methylsulfanyl)ethyl]cyclohexan-1-one.
| Compound Name | 2-[1-hydroxy-2,2-bis(methylsulfanyl)ethyl]cyclohexan-1-one |
|---|---|
| PubChem CID | 10955513 |
| Molecular Formula | C10H18O2S2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | 2-[1-hydroxy-2,2-bis(methylsulfanyl)ethyl]cyclohexan-1-one |
| SMILES | CSC(SC)C(O)C1CCCCC1=O |
| InChI | InChI=1S/C10H18O2S2/c1-13-10(14-2)9(12)7-5-3-4-6-8(7)11/h7,9-10,12H,3-6H2,1-2H3 |
| InChIKey | FAUDTCLGLVYFGP-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|