C13H24O2S2 — CID 135005942
(2S)-2-[(R)-1,3-dithian-2-yl(hydroxy)methyl]octanal (PubChem CID 135005942) has the molecular formula C13H24O2S2 and a molecular weight of 276.47 g/mol. Its IUPAC name is (2S)-2-[(R)-1,3-dithian-2-yl(hydroxy)methyl]octanal.
| Compound Name | (2S)-2-[(R)-1,3-dithian-2-yl(hydroxy)methyl]octanal |
|---|---|
| PubChem CID | 135005942 |
| Molecular Formula | C13H24O2S2 |
| Molecular Weight | 276.47 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | (2S)-2-[(R)-1,3-dithian-2-yl(hydroxy)methyl]octanal |
| SMILES | CCCCCC[C@H](C=O)[C@@H](O)C1SCCCS1 |
| InChI | InChI=1S/C13H24O2S2/c1-2-3-4-5-7-11(10-14)12(15)13-16-8-6-9-17-13/h10-13,15H,2-9H2,1H3/t11-,12-/m1/s1 |
| InChIKey | KSVSYYBLCPGNDA-VXGBXAGGSA-N |
| XLogP | 3.33 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.47 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|