C13H26O2S — CID 14386130
S-ethyl (2S,3R)-3-hydroxy-2-methyldecanethioate (PubChem CID 14386130) has the molecular formula C13H26O2S and a molecular weight of 246.42 g/mol. Its IUPAC name is S-ethyl (2S,3R)-3-hydroxy-2-methyldecanethioate.
| Compound Name | S-ethyl (2S,3R)-3-hydroxy-2-methyldecanethioate |
|---|---|
| PubChem CID | 14386130 |
| Molecular Formula | C13H26O2S |
| Molecular Weight | 246.42 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | S-ethyl (2S,3R)-3-hydroxy-2-methyldecanethioate |
| SMILES | CCCCCCC[C@@H](O)[C@H](C)C(=O)SCC |
| InChI | InChI=1S/C13H26O2S/c1-4-6-7-8-9-10-12(14)11(3)13(15)16-5-2/h11-12,14H,4-10H2,1-3H3/t11-,12+/m0/s1 |
| InChIKey | PTEIIPIZGHZZLD-NWDGAFQWSA-N |
| XLogP | 3.62 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.42 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|