C13H24O4S — CID 59125061
S-methyl (2S,4R,5S,6S,7R)-5,7-dihydroxy-2,4,6-trimethyl-3-oxononanethioate (PubChem CID 59125061) has the molecular formula C13H24O4S and a molecular weight of 276.40 g/mol. Its IUPAC name is S-methyl (2S,4R,5S,6S,7R)-5,7-dihydroxy-2,4,6-trimethyl-3-oxononanethioate.
| Compound Name | S-methyl (2S,4R,5S,6S,7R)-5,7-dihydroxy-2,4,6-trimethyl-3-oxononanethioate |
|---|---|
| PubChem CID | 59125061 |
| Molecular Formula | C13H24O4S |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | S-methyl (2S,4R,5S,6S,7R)-5,7-dihydroxy-2,4,6-trimethyl-3-oxononanethioate |
| SMILES | CC[C@@H](O)[C@H](C)[C@H](O)[C@@H](C)C(=O)[C@H](C)C(=O)SC |
| InChI | InChI=1S/C13H24O4S/c1-6-10(14)7(2)11(15)8(3)12(16)9(4)13(17)18-5/h7-11,14-15H,6H2,1-5H3/t7-,8+,9-,10+,11-/m0/s1 |
| InChIKey | XAZIBJBMYZAWGI-HWUMTFDVSA-N |
| XLogP | 1.49 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|