C19H36O5S — CID 59125072
S-methyl (2R,3S,4S,6R,8R,9S,10S,11R)-3,9,11-trihydroxy-2,4,6,8,10-pentamethyl-7-oxotridecanethioate (PubChem CID 59125072) has the molecular formula C19H36O5S and a molecular weight of 376.56 g/mol. Its IUPAC name is S-methyl (2R,3S,4S,6R,8R,9S,10S,11R)-3,9,11-trihydroxy-2,4,6,8,10-pentamethyl-7-oxotridecanethioate.
| Compound Name | S-methyl (2R,3S,4S,6R,8R,9S,10S,11R)-3,9,11-trihydroxy-2,4,6,8,10-pentamethyl-7-oxotridecanethioate |
|---|---|
| PubChem CID | 59125072 |
| Molecular Formula | C19H36O5S |
| Molecular Weight | 376.56 g/mol |
| Exact Mass | 376.23 |
| IUPAC Name | S-methyl (2R,3S,4S,6R,8R,9S,10S,11R)-3,9,11-trihydroxy-2,4,6,8,10-pentamethyl-7-oxotridecanethioate |
| SMILES | CC[C@@H](O)[C@H](C)[C@H](O)[C@@H](C)C(=O)[C@H](C)C[C@H](C)[C@H](O)[C@@H](C)C(=O)SC |
| InChI | InChI=1S/C19H36O5S/c1-8-15(20)12(4)18(23)13(5)16(21)10(2)9-11(3)17(22)14(6)19(24)25-7/h10-15,17-18,20,22-23H,8-9H2,1-7H3/t10-,11+,12+,13+,14-,15-,17+,18+/m1/s1 |
| InChIKey | FARXILRXNXFMFA-JAYJKGENSA-N |
| XLogP | 2.51 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.56 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|