C22H42O6S — CID 59125067
S-methyl (2R,3S,4R,5S,6S,8R,10R,11S,12S,13R)-3,5,11,13-tetrahydroxy-2,4,6,8,10,12-hexamethyl-9-oxopentadecanethioate (PubChem CID 59125067) has the molecular formula C22H42O6S and a molecular weight of 434.64 g/mol. Its IUPAC name is S-methyl (2R,3S,4R,5S,6S,8R,10R,11S,12S,13R)-3,5,11,13-tetrahydroxy-2,4,6,8,10,12-hexamethyl-9-oxopentadecanethioate.
| Compound Name | S-methyl (2R,3S,4R,5S,6S,8R,10R,11S,12S,13R)-3,5,11,13-tetrahydroxy-2,4,6,8,10,12-hexamethyl-9-oxopentadecanethioate |
|---|---|
| PubChem CID | 59125067 |
| Molecular Formula | C22H42O6S |
| Molecular Weight | 434.64 g/mol |
| Exact Mass | 434.27 |
| IUPAC Name | S-methyl (2R,3S,4R,5S,6S,8R,10R,11S,12S,13R)-3,5,11,13-tetrahydroxy-2,4,6,8,10,12-hexamethyl-9-oxopentadecanethioate |
| SMILES | CC[C@@H](O)[C@H](C)[C@H](O)[C@@H](C)C(=O)[C@H](C)C[C@H](C)[C@H](O)[C@@H](C)[C@H](O)[C@@H](C)C(=O)SC |
| InChI | InChI=1S/C22H42O6S/c1-9-17(23)13(4)20(26)14(5)18(24)11(2)10-12(3)19(25)15(6)21(27)16(7)22(28)29-8/h11-17,19-21,23,25-27H,9-10H2,1-8H3/t11-,12+,13+,14+,15-,16-,17-,19+,20+,21+/m1/s1 |
| InChIKey | RBRCJPOKFCBVTD-JKNGSDSYSA-N |
| XLogP | 2.51 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.64 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|