C10H20O3S — CID 59125075
S-methyl (2R,3S,4S,5R)-3,5-dihydroxy-2,4-dimethylheptanethioate (PubChem CID 59125075) has the molecular formula C10H20O3S and a molecular weight of 220.33 g/mol. Its IUPAC name is S-methyl (2R,3S,4S,5R)-3,5-dihydroxy-2,4-dimethylheptanethioate.
| Compound Name | S-methyl (2R,3S,4S,5R)-3,5-dihydroxy-2,4-dimethylheptanethioate |
|---|---|
| PubChem CID | 59125075 |
| Molecular Formula | C10H20O3S |
| Molecular Weight | 220.33 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | S-methyl (2R,3S,4S,5R)-3,5-dihydroxy-2,4-dimethylheptanethioate |
| SMILES | CC[C@@H](O)[C@H](C)[C@H](O)[C@@H](C)C(=O)SC |
| InChI | InChI=1S/C10H20O3S/c1-5-8(11)6(2)9(12)7(3)10(13)14-4/h6-9,11-12H,5H2,1-4H3/t6-,7+,8+,9-/m0/s1 |
| InChIKey | YTWZNEULYJVQSK-KDXUFGMBSA-N |
| XLogP | 1.28 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.33 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|