C16H30O4S — CID 59125056
S-methyl (2S,4R,6R,7S,8S,9R)-7,9-dihydroxy-2,4,6,8-tetramethyl-5-oxoundecanethioate (PubChem CID 59125056) has the molecular formula C16H30O4S and a molecular weight of 318.48 g/mol. Its IUPAC name is S-methyl (2S,4R,6R,7S,8S,9R)-7,9-dihydroxy-2,4,6,8-tetramethyl-5-oxoundecanethioate.
| Compound Name | S-methyl (2S,4R,6R,7S,8S,9R)-7,9-dihydroxy-2,4,6,8-tetramethyl-5-oxoundecanethioate |
|---|---|
| PubChem CID | 59125056 |
| Molecular Formula | C16H30O4S |
| Molecular Weight | 318.48 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | S-methyl (2S,4R,6R,7S,8S,9R)-7,9-dihydroxy-2,4,6,8-tetramethyl-5-oxoundecanethioate |
| SMILES | CC[C@@H](O)[C@H](C)[C@H](O)[C@@H](C)C(=O)[C@H](C)C[C@H](C)C(=O)SC |
| InChI | InChI=1S/C16H30O4S/c1-7-13(17)11(4)15(19)12(5)14(18)9(2)8-10(3)16(20)21-6/h9-13,15,17,19H,7-8H2,1-6H3/t9-,10+,11+,12+,13-,15+/m1/s1 |
| InChIKey | AJEPOWDPUBBCAD-IJPHXGJKSA-N |
| XLogP | 2.51 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.48 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|