C13H24O4 — CID 57154392
7-ethyl-6,8-dihydroxyundecane-2,4-dione (PubChem CID 57154392) has the molecular formula C13H24O4 and a molecular weight of 244.33 g/mol. Its IUPAC name is 7-ethyl-6,8-dihydroxyundecane-2,4-dione.
| Compound Name | 7-ethyl-6,8-dihydroxyundecane-2,4-dione |
|---|---|
| PubChem CID | 57154392 |
| Molecular Formula | C13H24O4 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | 7-ethyl-6,8-dihydroxyundecane-2,4-dione |
| SMILES | CCCC(O)C(CC)C(O)CC(=O)CC(C)=O |
| InChI | InChI=1S/C13H24O4/c1-4-6-12(16)11(5-2)13(17)8-10(15)7-9(3)14/h11-13,16-17H,4-8H2,1-3H3 |
| InChIKey | ZYQDGRDXZKVNBW-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|