C16H26O4 — CID 10978921
1-[(4aR,6R,7aR)-2,2,7,7-tetramethyl-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3]dioxin-6-yl]-3-methylpent-4-en-2-one (PubChem CID 10978921) has the molecular formula C16H26O4 and a molecular weight of 282.38 g/mol. Its IUPAC name is 1-[(4aR,6R,7aR)-2,2,7,7-tetramethyl-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3]dioxin-6-yl]-3-methylpent-4-en-2-one.
| Compound Name | 1-[(4aR,6R,7aR)-2,2,7,7-tetramethyl-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3]dioxin-6-yl]-3-methylpent-4-en-2-one |
|---|---|
| PubChem CID | 10978921 |
| Molecular Formula | C16H26O4 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | 1-[(4aR,6R,7aR)-2,2,7,7-tetramethyl-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3]dioxin-6-yl]-3-methylpent-4-en-2-one |
| SMILES | C=CC(C)C(=O)C[C@H]1O[C@@H]2COC(C)(C)O[C@@H]2C1(C)C |
| InChI | InChI=1S/C16H26O4/c1-7-10(2)11(17)8-13-15(3,4)14-12(19-13)9-18-16(5,6)20-14/h7,10,12-14H,1,8-9H2,2-6H3/t10?,12-,13-,14+/m1/s1 |
| InChIKey | NTWGANMQDKCPIL-KNEGCTHCSA-N |
| XLogP | 2.71 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|