C20H24O5 — CID 10980852
(2R,3R,9S,10S,11S)-10-hydroxy-11-methyl-2,9-bis(prop-1-en-2-yl)-4,13-dioxatricyclo[9.2.1.13,6]pentadeca-1(14),6(15)-diene-5,12-dione (PubChem CID 10980852) has the molecular formula C20H24O5 and a molecular weight of 344.41 g/mol. Its IUPAC name is (2R,3R,9S,10S,11S)-10-hydroxy-11-methyl-2,9-bis(prop-1-en-2-yl)-4,13-dioxatricyclo[9.2.1.13,6]pentadeca-1(14),6(15)-diene-5,12-dione.
| Compound Name | (2R,3R,9S,10S,11S)-10-hydroxy-11-methyl-2,9-bis(prop-1-en-2-yl)-4,13-dioxatricyclo[9.2.1.13,6]pentadeca-1(14),6(15)-diene-5,12-dione |
|---|---|
| PubChem CID | 10980852 |
| Molecular Formula | C20H24O5 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | (2R,3R,9S,10S,11S)-10-hydroxy-11-methyl-2,9-bis(prop-1-en-2-yl)-4,13-dioxatricyclo[9.2.1.13,6]pentadeca-1(14),6(15)-diene-5,12-dione |
| SMILES | C=C(C)[C@H]1C2=C[C@](C)(C(=O)O2)[C@@H](O)[C@H](C(=C)C)CCC2=C[C@H]1OC2=O |
| InChI | InChI=1S/C20H24O5/c1-10(2)13-7-6-12-8-14(24-18(12)22)16(11(3)4)15-9-20(5,17(13)21)19(23)25-15/h8-9,13-14,16-17,21H,1,3,6-7H2,2,4-5H3/t13-,14+,16+,17-,20-/m0/s1 |
| InChIKey | QFEYDWNEIMUBOK-YTRSDULBSA-N |
| XLogP | 2.82 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|