C26H28O4 — CID 10982338
(3R,4S)-3,4,5-tris(phenylmethoxy)pentanal (PubChem CID 10982338) has the molecular formula C26H28O4 and a molecular weight of 404.51 g/mol. Its IUPAC name is (3R,4S)-3,4,5-tris(phenylmethoxy)pentanal.
| Compound Name | (3R,4S)-3,4,5-tris(phenylmethoxy)pentanal |
|---|---|
| PubChem CID | 10982338 |
| Molecular Formula | C26H28O4 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | (3R,4S)-3,4,5-tris(phenylmethoxy)pentanal |
| SMILES | O=CC[C@@H](OCc1ccccc1)[C@H](COCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C26H28O4/c27-17-16-25(29-19-23-12-6-2-7-13-23)26(30-20-24-14-8-3-9-15-24)21-28-18-22-10-4-1-5-11-22/h1-15,17,25-26H,16,18-21H2/t25-,26+/m1/s1 |
| InChIKey | LGCMLMSLBSCDKD-FTJBHMTQSA-N |
| XLogP | 4.96 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|