C24H24ClN3O3 — CID 10982999
3-chloro-N-[(E)-[4-[2-(diethylamino)-2-oxoethyl]naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide (PubChem CID 10982999) has the molecular formula C24H24ClN3O3 and a molecular weight of 437.93 g/mol. Its IUPAC name is 3-chloro-N-[(E)-[4-[2-(diethylamino)-2-oxoethyl]naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide.
| Compound Name | 3-chloro-N-[(E)-[4-[2-(diethylamino)-2-oxoethyl]naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide |
|---|---|
| PubChem CID | 10982999 |
| Molecular Formula | C24H24ClN3O3 |
| Molecular Weight | 437.93 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | 3-chloro-N-[(E)-[4-[2-(diethylamino)-2-oxoethyl]naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide |
| SMILES | CCN(CC)C(=O)Cc1ccc(/C=N/NC(=O)c2ccc(O)c(Cl)c2)c2ccccc12 |
| InChI | InChI=1S/C24H24ClN3O3/c1-3-28(4-2)23(30)14-16-9-10-18(20-8-6-5-7-19(16)20)15-26-27-24(31)17-11-12-22(29)21(25)13-17/h5-13,15,29H,3-4,14H2,1-2H3,(H,27,31)/b26-15+ |
| InChIKey | GEOISDOUNNJVEU-CVKSISIWSA-N |
| XLogP | 4.37 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.93 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|