C30H26Cl2N4O3 — CID 10951864
3-chloro-N-[(E)-[4-[4-[(4-chlorophenyl)methyl]piperazine-1-carbonyl]naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide (PubChem CID 10951864) has the molecular formula C30H26Cl2N4O3 and a molecular weight of 561.47 g/mol. Its IUPAC name is 3-chloro-N-[(E)-[4-[4-[(4-chlorophenyl)methyl]piperazine-1-carbonyl]naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide.
| Compound Name | 3-chloro-N-[(E)-[4-[4-[(4-chlorophenyl)methyl]piperazine-1-carbonyl]naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide |
|---|---|
| PubChem CID | 10951864 |
| Molecular Formula | C30H26Cl2N4O3 |
| Molecular Weight | 561.47 g/mol |
| Exact Mass | 560.14 |
| IUPAC Name | 3-chloro-N-[(E)-[4-[4-[(4-chlorophenyl)methyl]piperazine-1-carbonyl]naphthalen-1-yl]methylideneamino]-4-hydroxybenzamide |
| SMILES | O=C(N/N=C/c1ccc(C(=O)N2CCN(Cc3ccc(Cl)cc3)CC2)c2ccccc12)c1ccc(O)c(Cl)c1 |
| InChI | InChI=1S/C30H26Cl2N4O3/c31-23-9-5-20(6-10-23)19-35-13-15-36(16-14-35)30(39)26-11-7-22(24-3-1-2-4-25(24)26)18-33-34-29(38)21-8-12-28(37)27(32)17-21/h1-12,17-18,37H,13-16,19H2,(H,34,38)/b33-18+ |
| InChIKey | KGZLHPADKMMSEL-DPNNOFEESA-N |
| XLogP | 5.57 |
| TPSA | 85.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.47 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|