C26H26ClN3O3 — CID 11091831
3-chloro-4-hydroxy-N-[(E)-[4-[2-(2-methylpiperidin-1-yl)-2-oxoethyl]naphthalen-1-yl]methylideneamino]benzamide (PubChem CID 11091831) has the molecular formula C26H26ClN3O3 and a molecular weight of 463.97 g/mol. Its IUPAC name is 3-chloro-4-hydroxy-N-[(E)-[4-[2-(2-methylpiperidin-1-yl)-2-oxoethyl]naphthalen-1-yl]methylideneamino]benzamide.
| Compound Name | 3-chloro-4-hydroxy-N-[(E)-[4-[2-(2-methylpiperidin-1-yl)-2-oxoethyl]naphthalen-1-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 11091831 |
| Molecular Formula | C26H26ClN3O3 |
| Molecular Weight | 463.97 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | 3-chloro-4-hydroxy-N-[(E)-[4-[2-(2-methylpiperidin-1-yl)-2-oxoethyl]naphthalen-1-yl]methylideneamino]benzamide |
| SMILES | CC1CCCCN1C(=O)Cc1ccc(/C=N/NC(=O)c2ccc(O)c(Cl)c2)c2ccccc12 |
| InChI | InChI=1S/C26H26ClN3O3/c1-17-6-4-5-13-30(17)25(32)15-18-9-10-20(22-8-3-2-7-21(18)22)16-28-29-26(33)19-11-12-24(31)23(27)14-19/h2-3,7-12,14,16-17,31H,4-6,13,15H2,1H3,(H,29,33)/b28-16+ |
| InChIKey | WUACEHRKTXWVKL-LQKURTRISA-N |
| XLogP | 4.91 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.97 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|