C27H28FN3O3 — CID 10983419
2-[[4-[(4-fluorophenyl)methyl]piperidin-1-yl]methyl]-3-(phenylcarbamoylamino)benzoic acid (PubChem CID 10983419) has the molecular formula C27H28FN3O3 and a molecular weight of 461.54 g/mol. Its IUPAC name is 2-[[4-[(4-fluorophenyl)methyl]piperidin-1-yl]methyl]-3-(phenylcarbamoylamino)benzoic acid.
| Compound Name | 2-[[4-[(4-fluorophenyl)methyl]piperidin-1-yl]methyl]-3-(phenylcarbamoylamino)benzoic acid |
|---|---|
| PubChem CID | 10983419 |
| Molecular Formula | C27H28FN3O3 |
| Molecular Weight | 461.54 g/mol |
| Exact Mass | 461.21 |
| IUPAC Name | 2-[[4-[(4-fluorophenyl)methyl]piperidin-1-yl]methyl]-3-(phenylcarbamoylamino)benzoic acid |
| SMILES | O=C(Nc1ccccc1)Nc1cccc(C(=O)O)c1CN1CCC(Cc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C27H28FN3O3/c28-21-11-9-19(10-12-21)17-20-13-15-31(16-14-20)18-24-23(26(32)33)7-4-8-25(24)30-27(34)29-22-5-2-1-3-6-22/h1-12,20H,13-18H2,(H,32,33)(H2,29,30,34) |
| InChIKey | CSDXAAUGKFBZOA-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.54 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |