C38H63NO4Si2 — CID 10985167
(3R,4R)-1-benzyl-4-[(1S,2S)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]nonyl]-3-phenylmethoxyazetidin-2-one (PubChem CID 10985167) has the molecular formula C38H63NO4Si2 and a molecular weight of 654.10 g/mol. Its IUPAC name is (3R,4R)-1-benzyl-4-[(1S,2S)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]nonyl]-3-phenylmethoxyazetidin-2-one.
| Compound Name | (3R,4R)-1-benzyl-4-[(1S,2S)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]nonyl]-3-phenylmethoxyazetidin-2-one |
|---|---|
| PubChem CID | 10985167 |
| Molecular Formula | C38H63NO4Si2 |
| Molecular Weight | 654.10 g/mol |
| Exact Mass | 653.43 |
| IUPAC Name | (3R,4R)-1-benzyl-4-[(1S,2S)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]nonyl]-3-phenylmethoxyazetidin-2-one |
| SMILES | CCCCCCC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1[C@@H](OCc2ccccc2)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C38H63NO4Si2/c1-12-13-14-15-22-27-32(42-44(8,9)37(2,3)4)34(43-45(10,11)38(5,6)7)33-35(41-29-31-25-20-17-21-26-31)36(40)39(33)28-30-23-18-16-19-24-30/h16-21,23-26,32-35H,12-15,22,27-29H2,1-11H3/t32-,33-,34+,35+/m0/s1 |
| InChIKey | YFGKHEFWDQIBSP-NUXXNWGHSA-N |
| XLogP | 10.12 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.10 |
| LogP ≤ 5 | 10.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|