C12H16O2 — CID 10987098
(1S,2S,3R,6R,7R)-3-hydroxy-4,4-dimethyltricyclo[5.2.1.02,6]dec-8-en-10-one (PubChem CID 10987098) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is (1S,2S,3R,6R,7R)-3-hydroxy-4,4-dimethyltricyclo[5.2.1.02,6]dec-8-en-10-one.
| Compound Name | (1S,2S,3R,6R,7R)-3-hydroxy-4,4-dimethyltricyclo[5.2.1.02,6]dec-8-en-10-one |
|---|---|
| PubChem CID | 10987098 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | (1S,2S,3R,6R,7R)-3-hydroxy-4,4-dimethyltricyclo[5.2.1.02,6]dec-8-en-10-one |
| SMILES | CC1(C)C[C@@H]2[C@@H]([C@@H]3C=C[C@H]2C3=O)[C@H]1O |
| InChI | InChI=1S/C12H16O2/c1-12(2)5-8-6-3-4-7(10(6)13)9(8)11(12)14/h3-4,6-9,11,14H,5H2,1-2H3/t6-,7+,8+,9-,11-/m1/s1 |
| InChIKey | DZICKLGPXKDKFV-KJFVXYAMSA-N |
| XLogP | 1.39 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|