C11H20O3 — CID 10987268
(5R,6R)-3,3-diethyl-5-methyl-6-prop-1-en-2-yl-1,2,4-trioxane (PubChem CID 10987268) has the molecular formula C11H20O3 and a molecular weight of 200.28 g/mol. Its IUPAC name is (5R,6R)-3,3-diethyl-5-methyl-6-prop-1-en-2-yl-1,2,4-trioxane.
| Compound Name | (5R,6R)-3,3-diethyl-5-methyl-6-prop-1-en-2-yl-1,2,4-trioxane |
|---|---|
| PubChem CID | 10987268 |
| Molecular Formula | C11H20O3 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | (5R,6R)-3,3-diethyl-5-methyl-6-prop-1-en-2-yl-1,2,4-trioxane |
| SMILES | C=C(C)[C@H]1OOC(CC)(CC)O[C@@H]1C |
| InChI | InChI=1S/C11H20O3/c1-6-11(7-2)12-9(5)10(8(3)4)13-14-11/h9-10H,3,6-7H2,1-2,4-5H3/t9-,10-/m1/s1 |
| InChIKey | QTQNDJGSHTXOLL-NXEZZACHSA-N |
| XLogP | 2.81 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|