C9H16O3 — CID 134992685
(5R,6R)-3-ethyl-5-methyl-6-prop-1-en-2-yl-1,2,4-trioxane (PubChem CID 134992685) has the molecular formula C9H16O3 and a molecular weight of 172.22 g/mol. Its IUPAC name is (5R,6R)-3-ethyl-5-methyl-6-prop-1-en-2-yl-1,2,4-trioxane.
| Compound Name | (5R,6R)-3-ethyl-5-methyl-6-prop-1-en-2-yl-1,2,4-trioxane |
|---|---|
| PubChem CID | 134992685 |
| Molecular Formula | C9H16O3 |
| Molecular Weight | 172.22 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | (5R,6R)-3-ethyl-5-methyl-6-prop-1-en-2-yl-1,2,4-trioxane |
| SMILES | C=C(C)[C@H]1OOC(CC)O[C@@H]1C |
| InChI | InChI=1S/C9H16O3/c1-5-8-10-7(4)9(6(2)3)12-11-8/h7-9H,2,5H2,1,3-4H3/t7-,8?,9-/m1/s1 |
| InChIKey | UMHSUGPOKKBOEO-PSGOWDBMSA-N |
| XLogP | 2.03 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.22 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|