C12H24O3 — CID 153447615
(4S)-4-(2,2-diethoxyethoxy)-2-methylpent-1-ene (PubChem CID 153447615) has the molecular formula C12H24O3 and a molecular weight of 216.32 g/mol. Its IUPAC name is (4S)-4-(2,2-diethoxyethoxy)-2-methylpent-1-ene.
| Compound Name | (4S)-4-(2,2-diethoxyethoxy)-2-methylpent-1-ene |
|---|---|
| PubChem CID | 153447615 |
| Molecular Formula | C12H24O3 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.17 |
| IUPAC Name | (4S)-4-(2,2-diethoxyethoxy)-2-methylpent-1-ene |
| SMILES | C=C(C)C[C@H](C)OCC(OCC)OCC |
| InChI | InChI=1S/C12H24O3/c1-6-13-12(14-7-2)9-15-11(5)8-10(3)4/h11-12H,3,6-9H2,1-2,4-5H3/t11-/m0/s1 |
| InChIKey | KWJVTIYFVUTMFZ-NSHDSACASA-N |
| XLogP | 2.76 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|