C14H20O — CID 10987373
(4aS,5S,6R)-5-ethenyl-5,6-dimethyl-2,3,4,4a,6,7-hexahydronaphthalen-1-one (PubChem CID 10987373) has the molecular formula C14H20O and a molecular weight of 204.31 g/mol. Its IUPAC name is (4aS,5S,6R)-5-ethenyl-5,6-dimethyl-2,3,4,4a,6,7-hexahydronaphthalen-1-one.
| Compound Name | (4aS,5S,6R)-5-ethenyl-5,6-dimethyl-2,3,4,4a,6,7-hexahydronaphthalen-1-one |
|---|---|
| PubChem CID | 10987373 |
| Molecular Formula | C14H20O |
| Molecular Weight | 204.31 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | (4aS,5S,6R)-5-ethenyl-5,6-dimethyl-2,3,4,4a,6,7-hexahydronaphthalen-1-one |
| SMILES | C=C[C@@]1(C)[C@H](C)CC=C2C(=O)CCC[C@H]21 |
| InChI | InChI=1S/C14H20O/c1-4-14(3)10(2)8-9-11-12(14)6-5-7-13(11)15/h4,9-10,12H,1,5-8H2,2-3H3/t10-,12-,14+/m1/s1 |
| InChIKey | OZJXOXKZCSHZSC-QKCSRTOESA-N |
| XLogP | 3.51 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.31 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|