C15H24 — CID 163047709
(1S,4S,5S,7aR)-5-ethenyl-1,4,5,7a-tetramethyl-2,4,6,7-tetrahydro-1H-indene (PubChem CID 163047709) has the molecular formula C15H24 and a molecular weight of 204.36 g/mol. Its IUPAC name is (1S,4S,5S,7aR)-5-ethenyl-1,4,5,7a-tetramethyl-2,4,6,7-tetrahydro-1H-indene.
| Compound Name | (1S,4S,5S,7aR)-5-ethenyl-1,4,5,7a-tetramethyl-2,4,6,7-tetrahydro-1H-indene |
|---|---|
| PubChem CID | 163047709 |
| Molecular Formula | C15H24 |
| Molecular Weight | 204.36 g/mol |
| Exact Mass | 204.19 |
| IUPAC Name | (1S,4S,5S,7aR)-5-ethenyl-1,4,5,7a-tetramethyl-2,4,6,7-tetrahydro-1H-indene |
| SMILES | C=C[C@]1(C)CC[C@@]2(C)C(=CC[C@@H]2C)[C@H]1C |
| InChI | InChI=1S/C15H24/c1-6-14(4)9-10-15(5)11(2)7-8-13(15)12(14)3/h6,8,11-12H,1,7,9-10H2,2-5H3/t11-,12+,14+,15+/m0/s1 |
| InChIKey | WWXVUFOHSHXMKJ-CTHBEMJXSA-N |
| XLogP | 4.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.36 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|