C19H30 — CID 101042420
(2S,4aS,4bR,10aS)-2-ethenyl-2,8,8-trimethyl-1,3,4,4a,4b,5,6,7,10,10a-decahydrophenanthrene (PubChem CID 101042420) has the molecular formula C19H30 and a molecular weight of 258.45 g/mol. Its IUPAC name is (2S,4aS,4bR,10aS)-2-ethenyl-2,8,8-trimethyl-1,3,4,4a,4b,5,6,7,10,10a-decahydrophenanthrene.
| Compound Name | (2S,4aS,4bR,10aS)-2-ethenyl-2,8,8-trimethyl-1,3,4,4a,4b,5,6,7,10,10a-decahydrophenanthrene |
|---|---|
| PubChem CID | 101042420 |
| Molecular Formula | C19H30 |
| Molecular Weight | 258.45 g/mol |
| Exact Mass | 258.23 |
| IUPAC Name | (2S,4aS,4bR,10aS)-2-ethenyl-2,8,8-trimethyl-1,3,4,4a,4b,5,6,7,10,10a-decahydrophenanthrene |
| SMILES | C=C[C@@]1(C)CC[C@H]2[C@@H](CC=C3[C@@H]2CCCC3(C)C)C1 |
| InChI | InChI=1S/C19H30/c1-5-19(4)12-10-15-14(13-19)8-9-17-16(15)7-6-11-18(17,2)3/h5,9,14-16H,1,6-8,10-13H2,2-4H3/t14-,15-,16+,19-/m0/s1 |
| InChIKey | FDBMTUZXDJYWTG-GGXPGOJBSA-N |
| XLogP | 5.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.45 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|