C20H32O — CID 101449335
[(3R,5aR,8R,10aS,10bR)-8-ethenyl-3,8,10a-trimethyl-2,5,5a,6,7,9,10,10b-octahydro-1H-cyclohepta[e]inden-3-yl]methanol (PubChem CID 101449335) has the molecular formula C20H32O and a molecular weight of 288.48 g/mol. Its IUPAC name is [(3R,5aR,8R,10aS,10bR)-8-ethenyl-3,8,10a-trimethyl-2,5,5a,6,7,9,10,10b-octahydro-1H-cyclohepta[e]inden-3-yl]methanol.
| Compound Name | [(3R,5aR,8R,10aS,10bR)-8-ethenyl-3,8,10a-trimethyl-2,5,5a,6,7,9,10,10b-octahydro-1H-cyclohepta[e]inden-3-yl]methanol |
|---|---|
| PubChem CID | 101449335 |
| Molecular Formula | C20H32O |
| Molecular Weight | 288.48 g/mol |
| Exact Mass | 288.25 |
| IUPAC Name | [(3R,5aR,8R,10aS,10bR)-8-ethenyl-3,8,10a-trimethyl-2,5,5a,6,7,9,10,10b-octahydro-1H-cyclohepta[e]inden-3-yl]methanol |
| SMILES | C=C[C@]1(C)CC[C@@H]2CC=C3[C@H](CC[C@@]3(C)CO)[C@@]2(C)CC1 |
| InChI | InChI=1S/C20H32O/c1-5-18(2)10-8-15-6-7-16-17(20(15,4)13-12-18)9-11-19(16,3)14-21/h5,7,15,17,21H,1,6,8-14H2,2-4H3/t15-,17-,18+,19-,20-/m0/s1 |
| InChIKey | LKLLGCCDBJPDEO-UVBQOVKKSA-N |
| XLogP | 5.11 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.48 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|